C24H32N6S — CID 3213458
1-cyclohexyl-4-[[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperazine (PubChem CID 3213458) has the molecular formula C24H32N6S and a molecular weight of 436.63 g/mol. Its IUPAC name is 1-cyclohexyl-4-[[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperazine.
| Compound Name | 1-cyclohexyl-4-[[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperazine |
|---|---|
| PubChem CID | 3213458 |
| Molecular Formula | C24H32N6S |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 1-cyclohexyl-4-[[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperazine |
| SMILES | c1ccc(CCn2nnnc2C(c2cccs2)N2CCN(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C24H32N6S/c1-3-8-20(9-4-1)13-14-30-24(25-26-27-30)23(22-12-7-19-31-22)29-17-15-28(16-18-29)21-10-5-2-6-11-21/h1,3-4,7-9,12,19,21,23H,2,5-6,10-11,13-18H2 |
| InChIKey | AFRCKWVTYQNNSP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |