C23H36N6 — CID 7397380
1-cyclopentyl-4-[(1S)-1-[1-(2-phenylethyl)tetrazol-5-yl]pentyl]piperazine (PubChem CID 7397380) has the molecular formula C23H36N6 and a molecular weight of 396.58 g/mol. Its IUPAC name is 1-cyclopentyl-4-[(1S)-1-[1-(2-phenylethyl)tetrazol-5-yl]pentyl]piperazine.
| Compound Name | 1-cyclopentyl-4-[(1S)-1-[1-(2-phenylethyl)tetrazol-5-yl]pentyl]piperazine |
|---|---|
| PubChem CID | 7397380 |
| Molecular Formula | C23H36N6 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 1-cyclopentyl-4-[(1S)-1-[1-(2-phenylethyl)tetrazol-5-yl]pentyl]piperazine |
| SMILES | CCCC[C@@H](c1nnnn1CCc1ccccc1)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C23H36N6/c1-2-3-13-22(28-18-16-27(17-19-28)21-11-7-8-12-21)23-24-25-26-29(23)15-14-20-9-5-4-6-10-20/h4-6,9-10,21-22H,2-3,7-8,11-19H2,1H3/t22-/m0/s1 |
| InChIKey | UBVNPEANJCLKBS-QFIPXVFZSA-N |
| XLogP | 3.71 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |