C21H38N6O — CID 5011336
1-cyclohexyl-4-[1-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]pentyl]piperazine (PubChem CID 5011336) has the molecular formula C21H38N6O and a molecular weight of 390.58 g/mol. Its IUPAC name is 1-cyclohexyl-4-[1-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]pentyl]piperazine.
| Compound Name | 1-cyclohexyl-4-[1-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]pentyl]piperazine |
|---|---|
| PubChem CID | 5011336 |
| Molecular Formula | C21H38N6O |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 1-cyclohexyl-4-[1-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]pentyl]piperazine |
| SMILES | CCCCC(c1nnnn1CC1CCCO1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H38N6O/c1-2-3-11-20(21-22-23-24-27(21)17-19-10-7-16-28-19)26-14-12-25(13-15-26)18-8-5-4-6-9-18/h18-20H,2-17H2,1H3 |
| InChIKey | WQQYSNSQYUCJRJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |