C18H32N6O — CID 7391891
1-[(1R)-1-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]pentyl]-4-prop-2-enylpiperazine (PubChem CID 7391891) has the molecular formula C18H32N6O and a molecular weight of 348.50 g/mol. Its IUPAC name is 1-[(1R)-1-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]pentyl]-4-prop-2-enylpiperazine.
| Compound Name | 1-[(1R)-1-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]pentyl]-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 7391891 |
| Molecular Formula | C18H32N6O |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | 1-[(1R)-1-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]pentyl]-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN([C@H](CCCC)c2nnnn2C[C@H]2CCCO2)CC1 |
| InChI | InChI=1S/C18H32N6O/c1-3-5-8-17(23-12-10-22(9-4-2)11-13-23)18-19-20-21-24(18)15-16-7-6-14-25-16/h4,16-17H,2-3,5-15H2,1H3/t16-,17-/m1/s1 |
| InChIKey | BGICORVRWRUROY-IAGOWNOFSA-N |
| XLogP | 1.89 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|