C19H27FN6O — CID 23913682
1-(4-fluorophenyl)-4-[1-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]propyl]piperazine (PubChem CID 23913682) has the molecular formula C19H27FN6O and a molecular weight of 374.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[1-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]propyl]piperazine.
| Compound Name | 1-(4-fluorophenyl)-4-[1-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]propyl]piperazine |
|---|---|
| PubChem CID | 23913682 |
| Molecular Formula | C19H27FN6O |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[1-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]propyl]piperazine |
| SMILES | CCC(c1nnnn1CC1CCCO1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H27FN6O/c1-2-18(19-21-22-23-26(19)14-17-4-3-13-27-17)25-11-9-24(10-12-25)16-7-5-15(20)6-8-16/h5-8,17-18H,2-4,9-14H2,1H3 |
| InChIKey | NARGBQJOTLJZTG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |