C20H30N6O — CID 7388864
1-[(1R)-2-methyl-1-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]propyl]-4-phenylpiperazine (PubChem CID 7388864) has the molecular formula C20H30N6O and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-[(1R)-2-methyl-1-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]propyl]-4-phenylpiperazine.
| Compound Name | 1-[(1R)-2-methyl-1-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]propyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 7388864 |
| Molecular Formula | C20H30N6O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 1-[(1R)-2-methyl-1-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]propyl]-4-phenylpiperazine |
| SMILES | CC(C)[C@H](c1nnnn1C[C@H]1CCCO1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H30N6O/c1-16(2)19(20-21-22-23-26(20)15-18-9-6-14-27-18)25-12-10-24(11-13-25)17-7-4-3-5-8-17/h3-5,7-8,16,18-19H,6,9-15H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | AEGZEFHWBRJXEF-RTBURBONSA-N |
| XLogP | 2.37 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |