C20H31N6O+ — CID 7388793
1-[(1S)-1-[1-[[(2S)-oxolan-2-yl]methyl]tetrazol-5-yl]butyl]-4-phenylpiperazin-1-ium (PubChem CID 7388793) has the molecular formula C20H31N6O+ and a molecular weight of 371.51 g/mol. Its IUPAC name is 1-[(1S)-1-[1-[[(2S)-oxolan-2-yl]methyl]tetrazol-5-yl]butyl]-4-phenylpiperazin-1-ium.
| Compound Name | 1-[(1S)-1-[1-[[(2S)-oxolan-2-yl]methyl]tetrazol-5-yl]butyl]-4-phenylpiperazin-1-ium |
|---|---|
| PubChem CID | 7388793 |
| Molecular Formula | C20H31N6O+ |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 1-[(1S)-1-[1-[[(2S)-oxolan-2-yl]methyl]tetrazol-5-yl]butyl]-4-phenylpiperazin-1-ium |
| SMILES | CCC[C@@H](c1nnnn1C[C@@H]1CCCO1)[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H30N6O/c1-2-7-19(20-21-22-23-26(20)16-18-10-6-15-27-18)25-13-11-24(12-14-25)17-8-4-3-5-9-17/h3-5,8-9,18-19H,2,6-7,10-16H2,1H3/p+1/t18-,19-/m0/s1 |
| InChIKey | YTMVMNAFXNQTGJ-OALUTQOASA-O |
| XLogP | 1.10 |
| TPSA | 60.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |