C22H35N6O2+ — CID 7388995
1-(4-methoxyphenyl)-4-[(1R)-3-methyl-1-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]butyl]piperazin-4-ium (PubChem CID 7388995) has the molecular formula C22H35N6O2+ and a molecular weight of 415.56 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-[(1R)-3-methyl-1-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]butyl]piperazin-4-ium.
| Compound Name | 1-(4-methoxyphenyl)-4-[(1R)-3-methyl-1-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]butyl]piperazin-4-ium |
|---|---|
| PubChem CID | 7388995 |
| Molecular Formula | C22H35N6O2+ |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-[(1R)-3-methyl-1-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]butyl]piperazin-4-ium |
| SMILES | COc1ccc(N2CC[NH+]([C@H](CC(C)C)c3nnnn3C[C@H]3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C22H34N6O2/c1-17(2)15-21(22-23-24-25-28(22)16-20-5-4-14-30-20)27-12-10-26(11-13-27)18-6-8-19(29-3)9-7-18/h6-9,17,20-21H,4-5,10-16H2,1-3H3/p+1/t20-,21-/m1/s1 |
| InChIKey | CBIBLYKFGPFRHC-NHCUHLMSSA-O |
| XLogP | 1.35 |
| TPSA | 69.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|