C20H31N6O2+ — CID 7388741
1-(4-methoxyphenyl)-4-[(1R)-1-[1-[[(2S)-oxolan-2-yl]methyl]tetrazol-5-yl]propyl]piperazin-4-ium (PubChem CID 7388741) has the molecular formula C20H31N6O2+ and a molecular weight of 387.51 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-[(1R)-1-[1-[[(2S)-oxolan-2-yl]methyl]tetrazol-5-yl]propyl]piperazin-4-ium.
| Compound Name | 1-(4-methoxyphenyl)-4-[(1R)-1-[1-[[(2S)-oxolan-2-yl]methyl]tetrazol-5-yl]propyl]piperazin-4-ium |
|---|---|
| PubChem CID | 7388741 |
| Molecular Formula | C20H31N6O2+ |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-[(1R)-1-[1-[[(2S)-oxolan-2-yl]methyl]tetrazol-5-yl]propyl]piperazin-4-ium |
| SMILES | CC[C@H](c1nnnn1C[C@@H]1CCCO1)[NH+]1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C20H30N6O2/c1-3-19(20-21-22-23-26(20)15-18-5-4-14-28-18)25-12-10-24(11-13-25)16-6-8-17(27-2)9-7-16/h6-9,18-19H,3-5,10-15H2,1-2H3/p+1/t18-,19+/m0/s1 |
| InChIKey | NTQRXOQNIIEAOS-RBUKOAKNSA-O |
| XLogP | 0.72 |
| TPSA | 69.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|