C19H31N6O+ — CID 7383943
1-[(1S)-1-(1-tert-butyltetrazol-5-yl)propyl]-4-(4-methoxyphenyl)piperazin-1-ium (PubChem CID 7383943) has the molecular formula C19H31N6O+ and a molecular weight of 359.50 g/mol. Its IUPAC name is 1-[(1S)-1-(1-tert-butyltetrazol-5-yl)propyl]-4-(4-methoxyphenyl)piperazin-1-ium.
| Compound Name | 1-[(1S)-1-(1-tert-butyltetrazol-5-yl)propyl]-4-(4-methoxyphenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 7383943 |
| Molecular Formula | C19H31N6O+ |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 1-[(1S)-1-(1-tert-butyltetrazol-5-yl)propyl]-4-(4-methoxyphenyl)piperazin-1-ium |
| SMILES | CC[C@@H](c1nnnn1C(C)(C)C)[NH+]1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C19H30N6O/c1-6-17(18-20-21-22-25(18)19(2,3)4)24-13-11-23(12-14-24)15-7-9-16(26-5)10-8-15/h7-10,17H,6,11-14H2,1-5H3/p+1/t17-/m0/s1 |
| InChIKey | DFCYKHFHIGDOID-KRWDZBQOSA-O |
| XLogP | 1.29 |
| TPSA | 60.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|