C20H33N6O+ — CID 7383966
1-[(1R)-1-(1-tert-butyltetrazol-5-yl)butyl]-4-(2-methoxyphenyl)piperazin-1-ium (PubChem CID 7383966) has the molecular formula C20H33N6O+ and a molecular weight of 373.53 g/mol. Its IUPAC name is 1-[(1R)-1-(1-tert-butyltetrazol-5-yl)butyl]-4-(2-methoxyphenyl)piperazin-1-ium.
| Compound Name | 1-[(1R)-1-(1-tert-butyltetrazol-5-yl)butyl]-4-(2-methoxyphenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 7383966 |
| Molecular Formula | C20H33N6O+ |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | 1-[(1R)-1-(1-tert-butyltetrazol-5-yl)butyl]-4-(2-methoxyphenyl)piperazin-1-ium |
| SMILES | CCC[C@H](c1nnnn1C(C)(C)C)[NH+]1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C20H32N6O/c1-6-9-17(19-21-22-23-26(19)20(2,3)4)25-14-12-24(13-15-25)16-10-7-8-11-18(16)27-5/h7-8,10-11,17H,6,9,12-15H2,1-5H3/p+1/t17-/m1/s1 |
| InChIKey | RISFZNWQOCYRGB-QGZVFWFLSA-O |
| XLogP | 1.68 |
| TPSA | 60.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |