C21H28N6OS — CID 3193621
1-[(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-(2-methoxyphenyl)piperazine (PubChem CID 3193621) has the molecular formula C21H28N6OS and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-[(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-(2-methoxyphenyl)piperazine.
| Compound Name | 1-[(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-(2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 3193621 |
| Molecular Formula | C21H28N6OS |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-[(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-(2-methoxyphenyl)piperazine |
| SMILES | COc1ccccc1N1CCN(C(c2cccs2)c2nnnn2C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H28N6OS/c1-21(2,3)27-20(22-23-24-27)19(18-10-7-15-29-18)26-13-11-25(12-14-26)16-8-5-6-9-17(16)28-4/h5-10,15,19H,11-14H2,1-4H3 |
| InChIKey | RELPIFSFXQOPMM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |