C27H32N6S — CID 28626221
1-benzhydryl-4-[(S)-(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazine (PubChem CID 28626221) has the molecular formula C27H32N6S and a molecular weight of 472.66 g/mol. Its IUPAC name is 1-benzhydryl-4-[(S)-(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazine.
| Compound Name | 1-benzhydryl-4-[(S)-(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazine |
|---|---|
| PubChem CID | 28626221 |
| Molecular Formula | C27H32N6S |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 1-benzhydryl-4-[(S)-(1-tert-butyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazine |
| SMILES | CC(C)(C)n1nnnc1[C@H](c1cccs1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H32N6S/c1-27(2,3)33-26(28-29-30-33)25(23-15-10-20-34-23)32-18-16-31(17-19-32)24(21-11-6-4-7-12-21)22-13-8-5-9-14-22/h4-15,20,24-25H,16-19H2,1-3H3/t25-/m0/s1 |
| InChIKey | SXLIMEMTJFMVKW-VWLOTQADSA-N |
| XLogP | 4.99 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |