C22H35N7O — CID 53300936
4-[2-[4-[(1-tert-butyltetrazol-5-yl)-phenylmethyl]piperazin-1-yl]ethyl]morpholine (PubChem CID 53300936) has the molecular formula C22H35N7O and a molecular weight of 413.57 g/mol. Its IUPAC name is 4-[2-[4-[(1-tert-butyltetrazol-5-yl)-phenylmethyl]piperazin-1-yl]ethyl]morpholine.
| Compound Name | 4-[2-[4-[(1-tert-butyltetrazol-5-yl)-phenylmethyl]piperazin-1-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 53300936 |
| Molecular Formula | C22H35N7O |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | 4-[2-[4-[(1-tert-butyltetrazol-5-yl)-phenylmethyl]piperazin-1-yl]ethyl]morpholine |
| SMILES | CC(C)(C)n1nnnc1C(c1ccccc1)N1CCN(CCN2CCOCC2)CC1 |
| InChI | InChI=1S/C22H35N7O/c1-22(2,3)29-21(23-24-25-29)20(19-7-5-4-6-8-19)28-13-11-26(12-14-28)9-10-27-15-17-30-18-16-27/h4-8,20H,9-18H2,1-3H3 |
| InChIKey | KXQZWWLPCQGZQC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 62.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |