C18H26N6O2 — CID 86284396
N-tert-butyl-2-[5-[morpholin-4-yl(phenyl)methyl]tetrazol-1-yl]acetamide (PubChem CID 86284396) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is N-tert-butyl-2-[5-[morpholin-4-yl(phenyl)methyl]tetrazol-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[5-[morpholin-4-yl(phenyl)methyl]tetrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 86284396 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | N-tert-butyl-2-[5-[morpholin-4-yl(phenyl)methyl]tetrazol-1-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)Cn1nnnc1C(c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C18H26N6O2/c1-18(2,3)19-15(25)13-24-17(20-21-22-24)16(14-7-5-4-6-8-14)23-9-11-26-12-10-23/h4-8,16H,9-13H2,1-3H3,(H,19,25) |
| InChIKey | CDQQWTMJVYLNPE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |