C30H30N10S2 — CID 98111414
1,4-bis[(S)-phenyl-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]methyl]piperazine (PubChem CID 98111414) has the molecular formula C30H30N10S2 and a molecular weight of 594.77 g/mol. Its IUPAC name is 1,4-bis[(S)-phenyl-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]methyl]piperazine.
| Compound Name | 1,4-bis[(S)-phenyl-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]methyl]piperazine |
|---|---|
| PubChem CID | 98111414 |
| Molecular Formula | C30H30N10S2 |
| Molecular Weight | 594.77 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | 1,4-bis[(S)-phenyl-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]methyl]piperazine |
| SMILES | c1ccc(C(c2nnnn2Cc2cccs2)N2CCN(C(c3ccccc3)c3nnnn3Cc3cccs3)CC2)cc1 |
| InChI | InChI=1S/C30H30N10S2/c1-3-9-23(10-4-1)27(29-31-33-35-39(29)21-25-13-7-19-41-25)37-15-17-38(18-16-37)28(24-11-5-2-6-12-24)30-32-34-36-40(30)22-26-14-8-20-42-26/h1-14,19-20,27-28H,15-18,21-22H2 |
| InChIKey | LSTBZZIIMOOSLW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 93.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.77 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |