C24H25FN6S — CID 1448470
1-benzyl-4-[(S)-(4-fluorophenyl)-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]methyl]piperazine (PubChem CID 1448470) has the molecular formula C24H25FN6S and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-benzyl-4-[(S)-(4-fluorophenyl)-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]methyl]piperazine.
| Compound Name | 1-benzyl-4-[(S)-(4-fluorophenyl)-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]methyl]piperazine |
|---|---|
| PubChem CID | 1448470 |
| Molecular Formula | C24H25FN6S |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 1-benzyl-4-[(S)-(4-fluorophenyl)-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]methyl]piperazine |
| SMILES | Fc1ccc([C@@H](c2nnnn2Cc2cccs2)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H25FN6S/c25-21-10-8-20(9-11-21)23(24-26-27-28-31(24)18-22-7-4-16-32-22)30-14-12-29(13-15-30)17-19-5-2-1-3-6-19/h1-11,16,23H,12-15,17-18H2/t23-/m0/s1 |
| InChIKey | OFLOLFCFVKUYMP-QHCPKHFHSA-N |
| XLogP | 3.83 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |