C25H31FN6 — CID 1443040
1-benzyl-4-[(S)-(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]piperazine (PubChem CID 1443040) has the molecular formula C25H31FN6 and a molecular weight of 434.56 g/mol. Its IUPAC name is 1-benzyl-4-[(S)-(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]piperazine.
| Compound Name | 1-benzyl-4-[(S)-(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 1443040 |
| Molecular Formula | C25H31FN6 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 1-benzyl-4-[(S)-(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]piperazine |
| SMILES | Fc1ccc([C@H](c2nnnn2C2CCCCC2)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H31FN6/c26-22-13-11-21(12-14-22)24(25-27-28-29-32(25)23-9-5-2-6-10-23)31-17-15-30(16-18-31)19-20-7-3-1-4-8-20/h1,3-4,7-8,11-14,23-24H,2,5-6,9-10,15-19H2/t24-/m1/s1 |
| InChIKey | LGNUYENXOUKSEF-XMMPIXPASA-N |
| XLogP | 4.22 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |