C21H30ClFN6 — CID 171668116
1-[(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]-4-prop-2-enylpiperazine;hydrochloride (PubChem CID 171668116) has the molecular formula C21H30ClFN6 and a molecular weight of 420.96 g/mol. Its IUPAC name is 1-[(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]-4-prop-2-enylpiperazine;hydrochloride.
| Compound Name | 1-[(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]-4-prop-2-enylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 171668116 |
| Molecular Formula | C21H30ClFN6 |
| Molecular Weight | 420.96 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-[(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]-4-prop-2-enylpiperazine;hydrochloride |
| SMILES | C=CCN1CCN(C(c2ccc(F)cc2)c2nnnn2C2CCCCC2)CC1.Cl |
| InChI | InChI=1S/C21H29FN6.ClH/c1-2-12-26-13-15-27(16-14-26)20(17-8-10-18(22)11-9-17)21-23-24-25-28(21)19-6-4-3-5-7-19;/h2,8-11,19-20H,1,3-7,12-16H2;1H |
| InChIKey | SLPKVTQKRYSDKH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.96 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|