C25H38N6 — CID 3208575
1-cyclohexyl-4-[(1-cyclohexyltetrazol-5-yl)-(4-methylphenyl)methyl]piperazine (PubChem CID 3208575) has the molecular formula C25H38N6 and a molecular weight of 422.62 g/mol. Its IUPAC name is 1-cyclohexyl-4-[(1-cyclohexyltetrazol-5-yl)-(4-methylphenyl)methyl]piperazine.
| Compound Name | 1-cyclohexyl-4-[(1-cyclohexyltetrazol-5-yl)-(4-methylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3208575 |
| Molecular Formula | C25H38N6 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | 1-cyclohexyl-4-[(1-cyclohexyltetrazol-5-yl)-(4-methylphenyl)methyl]piperazine |
| SMILES | Cc1ccc(C(c2nnnn2C2CCCCC2)N2CCN(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C25H38N6/c1-20-12-14-21(15-13-20)24(25-26-27-28-31(25)23-10-6-3-7-11-23)30-18-16-29(17-19-30)22-8-4-2-5-9-22/h12-15,22-24H,2-11,16-19H2,1H3 |
| InChIKey | ZKCFCARIMYYOFO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |