C26H34N6 — CID 3210504
1-cyclopentyl-4-[(4-methylphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]piperazine (PubChem CID 3210504) has the molecular formula C26H34N6 and a molecular weight of 430.60 g/mol. Its IUPAC name is 1-cyclopentyl-4-[(4-methylphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]piperazine.
| Compound Name | 1-cyclopentyl-4-[(4-methylphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]piperazine |
|---|---|
| PubChem CID | 3210504 |
| Molecular Formula | C26H34N6 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | 1-cyclopentyl-4-[(4-methylphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]piperazine |
| SMILES | Cc1ccc(C(c2nnnn2CCc2ccccc2)N2CCN(C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C26H34N6/c1-21-11-13-23(14-12-21)25(31-19-17-30(18-20-31)24-9-5-6-10-24)26-27-28-29-32(26)16-15-22-7-3-2-4-8-22/h2-4,7-8,11-14,24-25H,5-6,9-10,15-20H2,1H3 |
| InChIKey | MJMKYGVKACMINZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |