C21H26ClN5O — CID 171668621
4-[(4-methylphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]morpholine;hydrochloride (PubChem CID 171668621) has the molecular formula C21H26ClN5O and a molecular weight of 399.93 g/mol. Its IUPAC name is 4-[(4-methylphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]morpholine;hydrochloride.
| Compound Name | 4-[(4-methylphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 171668621 |
| Molecular Formula | C21H26ClN5O |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 4-[(4-methylphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]morpholine;hydrochloride |
| SMILES | Cc1ccc(C(c2nnnn2CCc2ccccc2)N2CCOCC2)cc1.Cl |
| InChI | InChI=1S/C21H25N5O.ClH/c1-17-7-9-19(10-8-17)20(25-13-15-27-16-14-25)21-22-23-24-26(21)12-11-18-5-3-2-4-6-18;/h2-10,20H,11-16H2,1H3;1H |
| InChIKey | MHNLXNJOOGWBSI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |