C24H26N6O2 — CID 1454854
6-methyl-3-[(R)-morpholin-4-yl-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-1H-quinolin-2-one (PubChem CID 1454854) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 6-methyl-3-[(R)-morpholin-4-yl-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-1H-quinolin-2-one.
| Compound Name | 6-methyl-3-[(R)-morpholin-4-yl-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1454854 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 6-methyl-3-[(R)-morpholin-4-yl-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-1H-quinolin-2-one |
| SMILES | Cc1ccc2[nH]c(=O)c([C@H](c3nnnn3CCc3ccccc3)N3CCOCC3)cc2c1 |
| InChI | InChI=1S/C24H26N6O2/c1-17-7-8-21-19(15-17)16-20(24(31)25-21)22(29-11-13-32-14-12-29)23-26-27-28-30(23)10-9-18-5-3-2-4-6-18/h2-8,15-16,22H,9-14H2,1H3,(H,25,31)/t22-/m1/s1 |
| InChIKey | JJJFROPLRSUUDW-JOCHJYFZSA-N |
| XLogP | 2.49 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |