C31H33N7O3 — CID 98100892
6-methoxy-3-[(R)-[4-(4-methoxyphenyl)piperazin-1-yl]-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-1H-quinolin-2-one (PubChem CID 98100892) has the molecular formula C31H33N7O3 and a molecular weight of 551.65 g/mol. Its IUPAC name is 6-methoxy-3-[(R)-[4-(4-methoxyphenyl)piperazin-1-yl]-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-1H-quinolin-2-one.
| Compound Name | 6-methoxy-3-[(R)-[4-(4-methoxyphenyl)piperazin-1-yl]-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 98100892 |
| Molecular Formula | C31H33N7O3 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 6-methoxy-3-[(R)-[4-(4-methoxyphenyl)piperazin-1-yl]-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-1H-quinolin-2-one |
| SMILES | COc1ccc(N2CCN([C@H](c3cc4cc(OC)ccc4[nH]c3=O)c3nnnn3CCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H33N7O3/c1-40-25-10-8-24(9-11-25)36-16-18-37(19-17-36)29(27-21-23-20-26(41-2)12-13-28(23)32-31(27)39)30-33-34-35-38(30)15-14-22-6-4-3-5-7-22/h3-13,20-21,29H,14-19H2,1-2H3,(H,32,39)/t29-/m1/s1 |
| InChIKey | KAOTWPLJRAILNT-GDLZYMKVSA-N |
| XLogP | 3.69 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|