C26H31N7O4 — CID 3150361
6-methoxy-3-[[1-(2-methoxyethyl)tetrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-quinolin-2-one (PubChem CID 3150361) has the molecular formula C26H31N7O4 and a molecular weight of 505.58 g/mol. Its IUPAC name is 6-methoxy-3-[[1-(2-methoxyethyl)tetrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-quinolin-2-one.
| Compound Name | 6-methoxy-3-[[1-(2-methoxyethyl)tetrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3150361 |
| Molecular Formula | C26H31N7O4 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 6-methoxy-3-[[1-(2-methoxyethyl)tetrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-quinolin-2-one |
| SMILES | COCCn1nnnc1C(c1cc2cc(OC)ccc2[nH]c1=O)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C26H31N7O4/c1-35-15-14-33-25(28-29-30-33)24(22-17-18-16-21(37-3)8-9-23(18)27-26(22)34)32-12-10-31(11-13-32)19-4-6-20(36-2)7-5-19/h4-9,16-17,24H,10-15H2,1-3H3,(H,27,34) |
| InChIKey | FLENPOLLIKCOPA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|