C27H33N7O3 — CID 28503240
6-ethyl-3-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-quinolin-2-one (PubChem CID 28503240) has the molecular formula C27H33N7O3 and a molecular weight of 503.61 g/mol. Its IUPAC name is 6-ethyl-3-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-quinolin-2-one.
| Compound Name | 6-ethyl-3-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 28503240 |
| Molecular Formula | C27H33N7O3 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | 6-ethyl-3-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-quinolin-2-one |
| SMILES | CCc1ccc2[nH]c(=O)c([C@H](c3nnnn3CCOC)N3CCN(c4ccc(OC)cc4)CC3)cc2c1 |
| InChI | InChI=1S/C27H33N7O3/c1-4-19-5-10-24-20(17-19)18-23(27(35)28-24)25(26-29-30-31-34(26)15-16-36-2)33-13-11-32(12-14-33)21-6-8-22(37-3)9-7-21/h5-10,17-18,25H,4,11-16H2,1-3H3,(H,28,35)/t25-/m1/s1 |
| InChIKey | MEOICWCHPRAGFT-RUZDIDTESA-N |
| XLogP | 2.64 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|