C21H28N6O3 — CID 7273018
6-ethoxy-3-[(S)-[1-(2-methoxyethyl)tetrazol-5-yl]-piperidin-1-ylmethyl]-1H-quinolin-2-one (PubChem CID 7273018) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 6-ethoxy-3-[(S)-[1-(2-methoxyethyl)tetrazol-5-yl]-piperidin-1-ylmethyl]-1H-quinolin-2-one.
| Compound Name | 6-ethoxy-3-[(S)-[1-(2-methoxyethyl)tetrazol-5-yl]-piperidin-1-ylmethyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 7273018 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 6-ethoxy-3-[(S)-[1-(2-methoxyethyl)tetrazol-5-yl]-piperidin-1-ylmethyl]-1H-quinolin-2-one |
| SMILES | CCOc1ccc2[nH]c(=O)c([C@@H](c3nnnn3CCOC)N3CCCCC3)cc2c1 |
| InChI | InChI=1S/C21H28N6O3/c1-3-30-16-7-8-18-15(13-16)14-17(21(28)22-18)19(26-9-5-4-6-10-26)20-23-24-25-27(20)11-12-29-2/h7-8,13-14,19H,3-6,9-12H2,1-2H3,(H,22,28)/t19-/m0/s1 |
| InChIKey | UJUIIYYTMDENOF-IBGZPJMESA-N |
| XLogP | 2.13 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |