C29H35N7O3 — CID 1147844
3-[(S)-(1-cyclohexyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6-methoxy-1H-quinolin-2-one (PubChem CID 1147844) has the molecular formula C29H35N7O3 and a molecular weight of 529.65 g/mol. Its IUPAC name is 3-[(S)-(1-cyclohexyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6-methoxy-1H-quinolin-2-one.
| Compound Name | 3-[(S)-(1-cyclohexyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6-methoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1147844 |
| Molecular Formula | C29H35N7O3 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | 3-[(S)-(1-cyclohexyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6-methoxy-1H-quinolin-2-one |
| SMILES | COc1ccc(N2CCN([C@@H](c3cc4cc(OC)ccc4[nH]c3=O)c3nnnn3C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C29H35N7O3/c1-38-23-10-8-21(9-11-23)34-14-16-35(17-15-34)27(28-31-32-33-36(28)22-6-4-3-5-7-22)25-19-20-18-24(39-2)12-13-26(20)30-29(25)37/h8-13,18-19,22,27H,3-7,14-17H2,1-2H3,(H,30,37)/t27-/m0/s1 |
| InChIKey | LNZWHIMAVSBYTG-MHZLTWQESA-N |
| XLogP | 3.95 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|