C30H37N7O2 — CID 1145587
3-[(S)-(1-cyclohexyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one (PubChem CID 1145587) has the molecular formula C30H37N7O2 and a molecular weight of 527.67 g/mol. Its IUPAC name is 3-[(S)-(1-cyclohexyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one.
| Compound Name | 3-[(S)-(1-cyclohexyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1145587 |
| Molecular Formula | C30H37N7O2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | 3-[(S)-(1-cyclohexyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one |
| SMILES | COc1ccc(N2CCN([C@@H](c3cc4cc(C)cc(C)c4[nH]c3=O)c3nnnn3C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C30H37N7O2/c1-20-17-21(2)27-22(18-20)19-26(30(38)31-27)28(29-32-33-34-37(29)24-7-5-4-6-8-24)36-15-13-35(14-16-36)23-9-11-25(39-3)12-10-23/h9-12,17-19,24,28H,4-8,13-16H2,1-3H3,(H,31,38)/t28-/m0/s1 |
| InChIKey | TXBNOMCUNFTWPE-NDEPHWFRSA-N |
| XLogP | 4.56 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|