C28H35N7O2 — CID 3150237
3-[(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one (PubChem CID 3150237) has the molecular formula C28H35N7O2 and a molecular weight of 501.64 g/mol. Its IUPAC name is 3-[(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one.
| Compound Name | 3-[(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3150237 |
| Molecular Formula | C28H35N7O2 |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | 3-[(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one |
| SMILES | COc1ccc(N2CCN(C(c3cc4cc(C)cc(C)c4[nH]c3=O)c3nnnn3C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C28H35N7O2/c1-18-15-19(2)24-20(16-18)17-23(27(36)29-24)25(26-30-31-32-35(26)28(3,4)5)34-13-11-33(12-14-34)21-7-9-22(37-6)10-8-21/h7-10,15-17,25H,11-14H2,1-6H3,(H,29,36) |
| InChIKey | DIYIMEIMWQGIIB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|