C27H33N7O2 — CID 1074286
3-[(R)-(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-8-methyl-1H-quinolin-2-one (PubChem CID 1074286) has the molecular formula C27H33N7O2 and a molecular weight of 487.61 g/mol. Its IUPAC name is 3-[(R)-(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-8-methyl-1H-quinolin-2-one.
| Compound Name | 3-[(R)-(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-8-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1074286 |
| Molecular Formula | C27H33N7O2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 3-[(R)-(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-8-methyl-1H-quinolin-2-one |
| SMILES | COc1ccc(N2CCN([C@H](c3cc4cccc(C)c4[nH]c3=O)c3nnnn3C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C27H33N7O2/c1-18-7-6-8-19-17-22(26(35)28-23(18)19)24(25-29-30-31-34(25)27(2,3)4)33-15-13-32(14-16-33)20-9-11-21(36-5)12-10-20/h6-12,17,24H,13-16H2,1-5H3,(H,28,35)/t24-/m1/s1 |
| InChIKey | BMPJNLDNTVOBIO-XMMPIXPASA-N |
| XLogP | 3.50 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|