C28H35N7O4 — CID 1373758
3-[(R)-(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6,7-dimethoxy-1H-quinolin-2-one (PubChem CID 1373758) has the molecular formula C28H35N7O4 and a molecular weight of 533.63 g/mol. Its IUPAC name is 3-[(R)-(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6,7-dimethoxy-1H-quinolin-2-one.
| Compound Name | 3-[(R)-(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6,7-dimethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1373758 |
| Molecular Formula | C28H35N7O4 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 3-[(R)-(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-6,7-dimethoxy-1H-quinolin-2-one |
| SMILES | COc1ccc(N2CCN([C@H](c3cc4cc(OC)c(OC)cc4[nH]c3=O)c3nnnn3C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C28H35N7O4/c1-28(2,3)35-26(30-31-32-35)25(34-13-11-33(12-14-34)19-7-9-20(37-4)10-8-19)21-15-18-16-23(38-5)24(39-6)17-22(18)29-27(21)36/h7-10,15-17,25H,11-14H2,1-6H3,(H,29,36)/t25-/m1/s1 |
| InChIKey | YELIXTBJGSXJDG-RUZDIDTESA-N |
| XLogP | 3.21 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|