C27H31N7O4 — CID 3187918
7-[(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one (PubChem CID 3187918) has the molecular formula C27H31N7O4 and a molecular weight of 517.59 g/mol. Its IUPAC name is 7-[(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one.
| Compound Name | 7-[(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
|---|---|
| PubChem CID | 3187918 |
| Molecular Formula | C27H31N7O4 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 7-[(1-tert-butyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
| SMILES | COc1ccc(N2CCN(C(c3cc4cc5c(cc4[nH]c3=O)OCO5)c3nnnn3C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C27H31N7O4/c1-27(2,3)34-25(29-30-31-34)24(33-11-9-32(10-12-33)18-5-7-19(36-4)8-6-18)20-13-17-14-22-23(38-16-37-22)15-21(17)28-26(20)35/h5-8,13-15,24H,9-12,16H2,1-4H3,(H,28,35) |
| InChIKey | NLKNIXKGHKYSGJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|