C28H31N7O4 — CID 3183705
7-[(1-cyclopentyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one (PubChem CID 3183705) has the molecular formula C28H31N7O4 and a molecular weight of 529.60 g/mol. Its IUPAC name is 7-[(1-cyclopentyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one.
| Compound Name | 7-[(1-cyclopentyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
|---|---|
| PubChem CID | 3183705 |
| Molecular Formula | C28H31N7O4 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 7-[(1-cyclopentyltetrazol-5-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
| SMILES | COc1ccc(N2CCN(C(c3cc4cc5c(cc4[nH]c3=O)OCO5)c3nnnn3C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C28H31N7O4/c1-37-21-8-6-19(7-9-21)33-10-12-34(13-11-33)26(27-30-31-32-35(27)20-4-2-3-5-20)22-14-18-15-24-25(39-17-38-24)16-23(18)29-28(22)36/h6-9,14-16,20,26H,2-5,10-13,17H2,1H3,(H,29,36) |
| InChIKey | QKQSBDUGOJIENT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|