C26H30N8O3 — CID 3150138
3-[(1-tert-butyltetrazol-5-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-8-methyl-1H-quinolin-2-one (PubChem CID 3150138) has the molecular formula C26H30N8O3 and a molecular weight of 502.58 g/mol. Its IUPAC name is 3-[(1-tert-butyltetrazol-5-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-8-methyl-1H-quinolin-2-one.
| Compound Name | 3-[(1-tert-butyltetrazol-5-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-8-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3150138 |
| Molecular Formula | C26H30N8O3 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 3-[(1-tert-butyltetrazol-5-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-8-methyl-1H-quinolin-2-one |
| SMILES | Cc1cccc2cc(C(c3nnnn3C(C)(C)C)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)c(=O)[nH]c12 |
| InChI | InChI=1S/C26H30N8O3/c1-17-6-5-7-18-16-21(25(35)27-22(17)18)23(24-28-29-30-33(24)26(2,3)4)32-14-12-31(13-15-32)19-8-10-20(11-9-19)34(36)37/h5-11,16,23H,12-15H2,1-4H3,(H,27,35) |
| InChIKey | FMFDVVNATOCGIV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 126.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|