C26H30N8O4 — CID 3187402
3-[[1-(2-methoxyethyl)tetrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one (PubChem CID 3187402) has the molecular formula C26H30N8O4 and a molecular weight of 518.58 g/mol. Its IUPAC name is 3-[[1-(2-methoxyethyl)tetrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one.
| Compound Name | 3-[[1-(2-methoxyethyl)tetrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3187402 |
| Molecular Formula | C26H30N8O4 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 3-[[1-(2-methoxyethyl)tetrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one |
| SMILES | COCCn1nnnc1C(c1cc2cc(C)cc(C)c2[nH]c1=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C26H30N8O4/c1-17-14-18(2)23-19(15-17)16-22(26(35)27-23)24(25-28-29-30-33(25)12-13-38-3)32-10-8-31(9-11-32)20-4-6-21(7-5-20)34(36)37/h4-7,14-16,24H,8-13H2,1-3H3,(H,27,35) |
| InChIKey | FDQOAGWVECXAPT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 135.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|