C31H32N8O3 — CID 3195838
5,7-dimethyl-3-[[4-(4-nitrophenyl)piperazin-1-yl]-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-1H-quinolin-2-one (PubChem CID 3195838) has the molecular formula C31H32N8O3 and a molecular weight of 564.65 g/mol. Its IUPAC name is 5,7-dimethyl-3-[[4-(4-nitrophenyl)piperazin-1-yl]-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-1H-quinolin-2-one.
| Compound Name | 5,7-dimethyl-3-[[4-(4-nitrophenyl)piperazin-1-yl]-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3195838 |
| Molecular Formula | C31H32N8O3 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | 5,7-dimethyl-3-[[4-(4-nitrophenyl)piperazin-1-yl]-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-1H-quinolin-2-one |
| SMILES | Cc1cc(C)c2cc(C(c3nnnn3CCc3ccccc3)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C31H32N8O3/c1-21-18-22(2)26-20-27(31(40)32-28(26)19-21)29(30-33-34-35-38(30)13-12-23-6-4-3-5-7-23)37-16-14-36(15-17-37)24-8-10-25(11-9-24)39(41)42/h3-11,18-20,29H,12-17H2,1-2H3,(H,32,40) |
| InChIKey | VMGUFKTWIIPFTH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 126.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|