C28H28N8O4 — CID 98100884
3-[(S)-[1-(furan-2-ylmethyl)tetrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-6,7-dimethyl-1H-quinolin-2-one (PubChem CID 98100884) has the molecular formula C28H28N8O4 and a molecular weight of 540.58 g/mol. Its IUPAC name is 3-[(S)-[1-(furan-2-ylmethyl)tetrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-6,7-dimethyl-1H-quinolin-2-one.
| Compound Name | 3-[(S)-[1-(furan-2-ylmethyl)tetrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-6,7-dimethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 98100884 |
| Molecular Formula | C28H28N8O4 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 3-[(S)-[1-(furan-2-ylmethyl)tetrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-6,7-dimethyl-1H-quinolin-2-one |
| SMILES | Cc1cc2cc([C@@H](c3nnnn3Cc3ccco3)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)c(=O)[nH]c2cc1C |
| InChI | InChI=1S/C28H28N8O4/c1-18-14-20-16-24(28(37)29-25(20)15-19(18)2)26(27-30-31-32-35(27)17-23-4-3-13-40-23)34-11-9-33(10-12-34)21-5-7-22(8-6-21)36(38)39/h3-8,13-16,26H,9-12,17H2,1-2H3,(H,29,37)/t26-/m0/s1 |
| InChIKey | KNFYBPAXGHXZFR-SANMLTNESA-N |
| XLogP | 3.59 |
| TPSA | 139.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|