C32H35N7O2 — CID 3192552
3-[[4-(4-methoxyphenyl)piperazin-1-yl]-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-7,8-dimethyl-1H-quinolin-2-one (PubChem CID 3192552) has the molecular formula C32H35N7O2 and a molecular weight of 549.68 g/mol. Its IUPAC name is 3-[[4-(4-methoxyphenyl)piperazin-1-yl]-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-7,8-dimethyl-1H-quinolin-2-one.
| Compound Name | 3-[[4-(4-methoxyphenyl)piperazin-1-yl]-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-7,8-dimethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3192552 |
| Molecular Formula | C32H35N7O2 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | 3-[[4-(4-methoxyphenyl)piperazin-1-yl]-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-7,8-dimethyl-1H-quinolin-2-one |
| SMILES | COc1ccc(N2CCN(C(c3cc4ccc(C)c(C)c4[nH]c3=O)c3nnnn3CCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H35N7O2/c1-22-9-10-25-21-28(32(40)33-29(25)23(22)2)30(31-34-35-36-39(31)16-15-24-7-5-4-6-8-24)38-19-17-37(18-20-38)26-11-13-27(41-3)14-12-26/h4-14,21,30H,15-20H2,1-3H3,(H,33,40) |
| InChIKey | BYDAPSUFXQLENS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|