C19H22N6O — CID 3229139
4-[[1-(2-phenylethyl)tetrazol-5-yl]-pyridin-3-ylmethyl]morpholine (PubChem CID 3229139) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is 4-[[1-(2-phenylethyl)tetrazol-5-yl]-pyridin-3-ylmethyl]morpholine.
| Compound Name | 4-[[1-(2-phenylethyl)tetrazol-5-yl]-pyridin-3-ylmethyl]morpholine |
|---|---|
| PubChem CID | 3229139 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 4-[[1-(2-phenylethyl)tetrazol-5-yl]-pyridin-3-ylmethyl]morpholine |
| SMILES | c1ccc(CCn2nnnc2C(c2cccnc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H22N6O/c1-2-5-16(6-3-1)8-10-25-19(21-22-23-25)18(17-7-4-9-20-15-17)24-11-13-26-14-12-24/h1-7,9,15,18H,8,10-14H2 |
| InChIKey | BEDDPIGCIAGYDH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |