C20H27N7 — CID 167557248
1-[(1-benzyltetrazol-5-yl)-pyridin-3-ylmethyl]-4-methylpiperazine;deuteriomethane (PubChem CID 167557248) has the molecular formula C20H27N7 and a molecular weight of 366.49 g/mol. Its IUPAC name is 1-[(1-benzyltetrazol-5-yl)-pyridin-3-ylmethyl]-4-methylpiperazine;deuteriomethane.
| Compound Name | 1-[(1-benzyltetrazol-5-yl)-pyridin-3-ylmethyl]-4-methylpiperazine;deuteriomethane |
|---|---|
| PubChem CID | 167557248 |
| Molecular Formula | C20H27N7 |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 1-[(1-benzyltetrazol-5-yl)-pyridin-3-ylmethyl]-4-methylpiperazine;deuteriomethane |
| SMILES | CN1CCN(C(c2cccnc2)c2nnnn2Cc2ccccc2)CC1.[2H]C |
| InChI | InChI=1S/C19H23N7.CH4/c1-24-10-12-25(13-11-24)18(17-8-5-9-20-14-17)19-21-22-23-26(19)15-16-6-3-2-4-7-16;/h2-9,14,18H,10-13,15H2,1H3;1H4/i;1D |
| InChIKey | DEAMQEXKDGCIMP-DIYDOPDJSA-N |
| XLogP | 2.09 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |