C21H26N6O — CID 1446292
1-[(R)-(1-benzyltetrazol-5-yl)-(2-methoxyphenyl)methyl]-4-methylpiperazine (PubChem CID 1446292) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-[(R)-(1-benzyltetrazol-5-yl)-(2-methoxyphenyl)methyl]-4-methylpiperazine.
| Compound Name | 1-[(R)-(1-benzyltetrazol-5-yl)-(2-methoxyphenyl)methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 1446292 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 1-[(R)-(1-benzyltetrazol-5-yl)-(2-methoxyphenyl)methyl]-4-methylpiperazine |
| SMILES | COc1ccccc1[C@H](c1nnnn1Cc1ccccc1)N1CCN(C)CC1 |
| InChI | InChI=1S/C21H26N6O/c1-25-12-14-26(15-13-25)20(18-10-6-7-11-19(18)28-2)21-22-23-24-27(21)16-17-8-4-3-5-9-17/h3-11,20H,12-16H2,1-2H3/t20-/m1/s1 |
| InChIKey | ZEYBDMHALDAFSH-HXUWFJFHSA-N |
| XLogP | 2.07 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |