C20H22F2N6 — CID 3209891
1-[(2-fluorophenyl)-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]methyl]-4-methylpiperazine (PubChem CID 3209891) has the molecular formula C20H22F2N6 and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]methyl]-4-methylpiperazine.
| Compound Name | 1-[(2-fluorophenyl)-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 3209891 |
| Molecular Formula | C20H22F2N6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 1-[(2-fluorophenyl)-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]methyl]-4-methylpiperazine |
| SMILES | CN1CCN(C(c2ccccc2F)c2nnnn2Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H22F2N6/c1-26-10-12-27(13-11-26)19(17-4-2-3-5-18(17)22)20-23-24-25-28(20)14-15-6-8-16(21)9-7-15/h2-9,19H,10-14H2,1H3 |
| InChIKey | AOMNEHHJJYOWGF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |