C18H27FN6 — CID 3209809
1-[1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-3-methylbutyl]-4-methylpiperazine (PubChem CID 3209809) has the molecular formula C18H27FN6 and a molecular weight of 346.45 g/mol. Its IUPAC name is 1-[1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-3-methylbutyl]-4-methylpiperazine.
| Compound Name | 1-[1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-3-methylbutyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 3209809 |
| Molecular Formula | C18H27FN6 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-[1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-3-methylbutyl]-4-methylpiperazine |
| SMILES | CC(C)CC(c1nnnn1Cc1ccc(F)cc1)N1CCN(C)CC1 |
| InChI | InChI=1S/C18H27FN6/c1-14(2)12-17(24-10-8-23(3)9-11-24)18-20-21-22-25(18)13-15-4-6-16(19)7-5-15/h4-7,14,17H,8-13H2,1-3H3 |
| InChIKey | WAOWXCWTKFSOJA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |