C23H29FN6 — CID 1446104
1-[(1R)-1-(1-benzyltetrazol-5-yl)-3-methylbutyl]-4-(2-fluorophenyl)piperazine (PubChem CID 1446104) has the molecular formula C23H29FN6 and a molecular weight of 408.53 g/mol. Its IUPAC name is 1-[(1R)-1-(1-benzyltetrazol-5-yl)-3-methylbutyl]-4-(2-fluorophenyl)piperazine.
| Compound Name | 1-[(1R)-1-(1-benzyltetrazol-5-yl)-3-methylbutyl]-4-(2-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 1446104 |
| Molecular Formula | C23H29FN6 |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 1-[(1R)-1-(1-benzyltetrazol-5-yl)-3-methylbutyl]-4-(2-fluorophenyl)piperazine |
| SMILES | CC(C)C[C@H](c1nnnn1Cc1ccccc1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H29FN6/c1-18(2)16-22(23-25-26-27-30(23)17-19-8-4-3-5-9-19)29-14-12-28(13-15-29)21-11-7-6-10-20(21)24/h3-11,18,22H,12-17H2,1-2H3/t22-/m1/s1 |
| InChIKey | VPSCFTJBMUHSKH-JOCHJYFZSA-N |
| XLogP | 3.77 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |