C25H25FN6 — CID 1446149
1-[(S)-(1-benzyltetrazol-5-yl)-phenylmethyl]-4-(2-fluorophenyl)piperazine (PubChem CID 1446149) has the molecular formula C25H25FN6 and a molecular weight of 428.52 g/mol. Its IUPAC name is 1-[(S)-(1-benzyltetrazol-5-yl)-phenylmethyl]-4-(2-fluorophenyl)piperazine.
| Compound Name | 1-[(S)-(1-benzyltetrazol-5-yl)-phenylmethyl]-4-(2-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 1446149 |
| Molecular Formula | C25H25FN6 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-[(S)-(1-benzyltetrazol-5-yl)-phenylmethyl]-4-(2-fluorophenyl)piperazine |
| SMILES | Fc1ccccc1N1CCN([C@@H](c2ccccc2)c2nnnn2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H25FN6/c26-22-13-7-8-14-23(22)30-15-17-31(18-16-30)24(21-11-5-2-6-12-21)25-27-28-29-32(25)19-20-9-3-1-4-10-20/h1-14,24H,15-19H2/t24-/m0/s1 |
| InChIKey | FJIDLPUZPWPXEF-DEOSSOPVSA-N |
| XLogP | 3.77 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |