C25H24F2N6 — CID 1446365
1-[(S)-(1-benzyltetrazol-5-yl)-(2-fluorophenyl)methyl]-4-(4-fluorophenyl)piperazine (PubChem CID 1446365) has the molecular formula C25H24F2N6 and a molecular weight of 446.51 g/mol. Its IUPAC name is 1-[(S)-(1-benzyltetrazol-5-yl)-(2-fluorophenyl)methyl]-4-(4-fluorophenyl)piperazine.
| Compound Name | 1-[(S)-(1-benzyltetrazol-5-yl)-(2-fluorophenyl)methyl]-4-(4-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 1446365 |
| Molecular Formula | C25H24F2N6 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 1-[(S)-(1-benzyltetrazol-5-yl)-(2-fluorophenyl)methyl]-4-(4-fluorophenyl)piperazine |
| SMILES | Fc1ccc(N2CCN([C@@H](c3ccccc3F)c3nnnn3Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H24F2N6/c26-20-10-12-21(13-11-20)31-14-16-32(17-15-31)24(22-8-4-5-9-23(22)27)25-28-29-30-33(25)18-19-6-2-1-3-7-19/h1-13,24H,14-18H2/t24-/m0/s1 |
| InChIKey | JUPGPAVEHHWFIF-DEOSSOPVSA-N |
| XLogP | 3.91 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |