C23H29FN6 — CID 43812335
1-benzyl-4-[1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]butyl]piperazine (PubChem CID 43812335) has the molecular formula C23H29FN6 and a molecular weight of 408.53 g/mol. Its IUPAC name is 1-benzyl-4-[1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]butyl]piperazine.
| Compound Name | 1-benzyl-4-[1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]butyl]piperazine |
|---|---|
| PubChem CID | 43812335 |
| Molecular Formula | C23H29FN6 |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 1-benzyl-4-[1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]butyl]piperazine |
| SMILES | CCCC(c1nnnn1Cc1ccc(F)cc1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H29FN6/c1-2-6-22(23-25-26-27-30(23)18-20-9-11-21(24)12-10-20)29-15-13-28(14-16-29)17-19-7-4-3-5-8-19/h3-5,7-12,22H,2,6,13-18H2,1H3 |
| InChIKey | HVUBLPNKMFODDG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |