C20H32N6 — CID 1443719
1-benzyl-4-[(1S)-1-(1-tert-butyltetrazol-5-yl)butyl]piperazine (PubChem CID 1443719) has the molecular formula C20H32N6 and a molecular weight of 356.52 g/mol. Its IUPAC name is 1-benzyl-4-[(1S)-1-(1-tert-butyltetrazol-5-yl)butyl]piperazine.
| Compound Name | 1-benzyl-4-[(1S)-1-(1-tert-butyltetrazol-5-yl)butyl]piperazine |
|---|---|
| PubChem CID | 1443719 |
| Molecular Formula | C20H32N6 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 1-benzyl-4-[(1S)-1-(1-tert-butyltetrazol-5-yl)butyl]piperazine |
| SMILES | CCC[C@@H](c1nnnn1C(C)(C)C)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H32N6/c1-5-9-18(19-21-22-23-26(19)20(2,3)4)25-14-12-24(13-15-25)16-17-10-7-6-8-11-17/h6-8,10-11,18H,5,9,12-16H2,1-4H3/t18-/m0/s1 |
| InChIKey | XESPENSQQYSNAD-SFHVURJKSA-N |
| XLogP | 3.09 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |