C20H32ClN6O- — CID 53314022
1-benzyl-4-[1-[1-(2-methoxyethyl)tetrazol-5-yl]pentyl]piperazine chloride (PubChem CID 53314022) has the molecular formula C20H32ClN6O- and a molecular weight of 407.97 g/mol. Its IUPAC name is 1-benzyl-4-[1-[1-(2-methoxyethyl)tetrazol-5-yl]pentyl]piperazine chloride.
| Compound Name | 1-benzyl-4-[1-[1-(2-methoxyethyl)tetrazol-5-yl]pentyl]piperazine chloride |
|---|---|
| PubChem CID | 53314022 |
| Molecular Formula | C20H32ClN6O- |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 1-benzyl-4-[1-[1-(2-methoxyethyl)tetrazol-5-yl]pentyl]piperazine chloride |
| SMILES | CCCCC(c1nnnn1CCOC)N1CCN(Cc2ccccc2)CC1.[Cl-] |
| InChI | InChI=1S/C20H32N6O.ClH/c1-3-4-10-19(20-21-22-23-26(20)15-16-27-2)25-13-11-24(12-14-25)17-18-8-6-5-7-9-18;/h5-9,19H,3-4,10-17H2,1-2H3;1H/p-1 |
| InChIKey | SDCCDLUQUDJRKT-UHFFFAOYSA-M |
| XLogP | -0.63 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |